NAVIGATION
QUICK INQUIRY
What is the molecular formula of (4Z,7Z,10Z,13Z,16Z)-docosapentaenoic acid?
The molecular formula is C22H34O2.
What are some synonyms for (4Z,7Z,10Z,13Z,16Z)-docosapentaenoic acid?
Some synonyms are Osbond acid, all-cis-4,7,10,13,16-Docosapentaenoic acid, and Docosapentaenoic acid (22n-6).
What is the molecular weight of (4Z,7Z,10Z,13Z,16Z)-docosapentaenoic acid?
The molecular weight is 330.5 g/mol.
What is the role of (4Z,7Z,10Z,13Z,16Z)-docosapentaenoic acid?
It has a role as a Daphnia tenebrosa metabolite, a human metabolite, and an algal metabolite.
What is the IUPAC name of (4Z,7Z,10Z,13Z,16Z)-docosapentaenoic acid?
The IUPAC name is (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoic acid.
What is the InChI of (4Z,7Z,10Z,13Z,16Z)-docosapentaenoic acid?
The InChI is InChI=1S/C22H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h6-7,9-10,12-13,15-16,18-19H,2-5,8,11,14,17,20-21H2,1H3,(H,23,24)/b7-6-,10-9-,13-12-,16-15-,19-18-.
What is the InChIKey of (4Z,7Z,10Z,13Z,16Z)-docosapentaenoic acid?
The InChIKey is AVKOENOBFIYBSA-WMPRHZDHSA-N.
What are the CAS numbers associated with (4Z,7Z,10Z,13Z,16Z)-docosapentaenoic acid?
The CAS numbers are 25182-74-5 and 25448-00-4.
How many hydrogen bond donor count does (4Z,7Z,10Z,13Z,16Z)-docosapentaenoic acid have?
It has 1 hydrogen bond donor count.
How many rotatable bond count does (4Z,7Z,10Z,13Z,16Z)-docosapentaenoic acid have?
It has 15 rotatable bond count.
