NAVIGATION
QUICK INQUIRY
What is the molecular formula of 9E-hexadecenyl acetate?
The molecular formula of 9E-hexadecenyl acetate is C18H34O2.
What is the molecular weight of 9E-hexadecenyl acetate?
The molecular weight of 9E-hexadecenyl acetate is 282.5 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of 9E-hexadecenyl acetate is [(E)-hexadec-9-enyl] acetate.
What is the InChI of 9E-hexadecenyl acetate?
The InChI of 9E-hexadecenyl acetate is InChI=1S/C18H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h8-9H,3-7,10-17H2,1-2H3/b9-8+.
What is the InChIKey of the compound?
The InChIKey of 9E-hexadecenyl acetate is VAKBQCYSUVICLV-CMDGGOBGSA-N.
What are the synonyms of 9E-hexadecenyl acetate?
The synonyms of 9E-hexadecenyl acetate include (E)-9-Hexadecenyl acetate, 56218-69-0, and 9-hexadecenyl acetate.
What is the CAS number of 9E-hexadecenyl acetate?
The CAS number of 9E-hexadecenyl acetate is 56218-69-0.
What is the Lipid Maps ID (LM_ID) of the compound?
The Lipid Maps ID (LM_ID) of 9E-hexadecenyl acetate is LMFA07010347.
What is the formal charge of 9E-hexadecenyl acetate?
The formal charge of 9E-hexadecenyl acetate is 0.
Is the compound canonicalized?
Yes, the compound is canonicalized.
