NAVIGATION
QUICK INQUIRY
What is the molecular formula of cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester?
The molecular formula of cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester is C22H34O2.
What are the synonyms of cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester?
The synonyms of cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester are ICOSAPENT ETHYL, ethyl icosapentate, ethyl eicosapentaenoate, and Epadel.
What is the molecular weight of cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester?
The molecular weight of cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester is 330.5 g/mol.
What is the role of cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester?
cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester has a role as an anticholesteremic drug, a marine metabolite, an antipsychotic agent, an antidepressant, and a prodrug.
What is the IUPAC name of cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester?
The IUPAC name of cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester is ethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate.
What is the InChI of cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester?
The InChI of cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester is InChI=1S/C22H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h5-6,8-9,11-12,14-15,17-18H,3-4,7,10,13,16,19-21H2,1-2H3/b6-5-,9-8-,12-11-,15-14-,18-17-.
What is the InChIKey of cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester?
The InChIKey of cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester is SSQPWTVBQMWLSZ-AAQCHOMXSA-N.
What are the other identifiers of cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester?
The other identifiers of cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester are CAS numbers 86227-47-6 and 73310-10-8, European Community (EC) Number 694-907-4, NSC Number 759597, UNII 6GC8A4PAYH, and DSSTox Substance ID DTXSID601018686.
What is the use of cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester in medicine?
cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester is used as an adjunct therapy for severe hypertriglyceridemia and to reduce the risk of cardiovascular events in certain patients with elevated triglycerides.
When was cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester approved by the FDA?
cis-5,8,11,14,17-Eicosapentaenoic acid ethyl ester was FDA approved on July 26, 2012.
trans-13-Docosenoic Acidmethyl ester
CAS: 7439-44-3
12R-Hydroxy-9-trans-octadecenoic Acid
CAS: 82188-83-8
CAS: 82807-36-1
CAS: 90176-52-6
cis-11,14,17-Eicosatrienoic acid ethyl ester
CAS: 99660-95-4
CAS: 112-39-0