NAVIGATION
QUICK INQUIRY
What is the molecular formula of cis-6-Octadecenoic acid methyl ester?
The molecular formula of cis-6-Octadecenoic acid methyl ester is C19H36O2.
What are some synonyms of cis-6-Octadecenoic acid methyl ester?
Some synonyms of cis-6-Octadecenoic acid methyl ester are Methyl petroselinate, Petroselinic acid methyl ester, and Methyl (Z)-octadec-6-enoate.
What is the molecular weight of cis-6-Octadecenoic acid methyl ester?
The molecular weight of cis-6-Octadecenoic acid methyl ester is 296.5 g/mol.
What is the IUPAC name of cis-6-Octadecenoic acid methyl ester?
The IUPAC name of cis-6-Octadecenoic acid methyl ester is methyl (Z)-octadec-6-enoate.
What is the InChI of cis-6-Octadecenoic acid methyl ester?
The InChI of cis-6-Octadecenoic acid methyl ester is InChI=1S/C19H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h13-14H,3-12,15-18H2,1-2H3/b14-13-.
What is the InChIKey of cis-6-Octadecenoic acid methyl ester?
The InChIKey of cis-6-Octadecenoic acid methyl ester is QRTVDKVXAFJVRU-YPKPFQOOSA-N.
What is the canonical SMILES of cis-6-Octadecenoic acid methyl ester?
The canonical SMILES of cis-6-Octadecenoic acid methyl ester is CCCCCCCCCCCC=CCCCCC(=O)OC.
What is the CAS number of cis-6-Octadecenoic acid methyl ester?
The CAS number of cis-6-Octadecenoic acid methyl ester is 2777-58-4.
What is the European Community (EC) number of cis-6-Octadecenoic acid methyl ester?
The European Community (EC) number of cis-6-Octadecenoic acid methyl ester is 220-470-2.
What is the hydrogen bond donor count of cis-6-Octadecenoic acid methyl ester?
The hydrogen bond donor count of cis-6-Octadecenoic acid methyl ester is 0.