NAVIGATION
QUICK INQUIRY
What is the PubChem CID of Isopropyl oleate?
The PubChem CID of Isopropyl oleate is 5356108.
What is the molecular formula of Isopropyl oleate?
The molecular formula of Isopropyl oleate is C21H40O2.
What are some synonyms of Isopropyl oleate?
Some synonyms of Isopropyl oleate are Oleic acid, isopropyl ester and 9-Octadecenoic acid (9Z)-, 1-methylethyl ester.
What is the molecular weight of Isopropyl oleate?
The molecular weight of Isopropyl oleate is 324.5 g/mol.
What is the IUPAC name of Isopropyl oleate?
The IUPAC name of Isopropyl oleate is propan-2-yl (Z)-octadec-9-enoate.
What is the InChI of Isopropyl oleate?
The InChI of Isopropyl oleate is InChI=1S/C21H40O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(22)23-20(2)3/h11-12,20H,4-10,13-19H2,1-3H3/b12-11-.
What is the InChIKey of Isopropyl oleate?
The InChIKey of Isopropyl oleate is PZQSQRCNMZGWFT-QXMHVHEDSA-N.
What is the canonical SMILES of Isopropyl oleate?
The canonical SMILES of Isopropyl oleate is CCCCCCCCC=CCCCCCCCC(=O)OC(C)C.
What is the isomeric SMILES of Isopropyl oleate?
The isomeric SMILES of Isopropyl oleate is CCCCCCCC/C=C\CCCCCCCC(=O)OC(C)C.
What is the CAS number of Isopropyl oleate?
The CAS number of Isopropyl oleate is 112-11-8.
N-(6-Hydroxyhexyl)trifluoroacetamide
CAS: 40248-34-8
CAS: 10369-83-2
CAS: 106-02-5
CAS: 111-58-0