NAVIGATION
QUICK INQUIRY
What is the molecular formula of tridecyl acetate?
The molecular formula of tridecyl acetate is C15H30O2.
What is the molecular weight of tridecyl acetate?
The molecular weight of tridecyl acetate is 242.40 g/mol.
What is the IUPAC Name of tridecyl acetate?
The IUPAC Name of tridecyl acetate is tridecyl acetate.
What is the Canonical SMILES of tridecyl acetate?
The Canonical SMILES of tridecyl acetate is CCCCCCCCCCCCCOC(=O)C.
What is the InChI of tridecyl acetate?
The InChI of tridecyl acetate is InChI=1S/C15H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-17-15(2)16/h3-14H2,1-2H3.
What is the InChIKey of tridecyl acetate?
The InChIKey of tridecyl acetate is ZDRNMODJXFOYMN-UHFFFAOYSA-N.
How many hydrogen bond acceptor counts does tridecyl acetate have?
Tridecyl acetate has 2 hydrogen bond acceptor counts.
What is the topological polar surface area of tridecyl acetate?
The topological polar surface area of tridecyl acetate is 26.3 Ų.
Does tridecyl acetate have any defined bond stereocenter counts?
No, tridecyl acetate does not have any defined bond stereocenter counts.
Is tridecyl acetate considered a canonicalized compound?
Yes, tridecyl acetate is considered a canonicalized compound.