NAVIGATION
QUICK INQUIRY
What is the molecular formula of 2-Hydroxytetracosanoic acid?
The molecular formula of 2-Hydroxytetracosanoic acid is C24H48O3.
What are the synonyms for 2-Hydroxytetracosanoic acid?
The synonyms for 2-Hydroxytetracosanoic acid are Cerebronic acid, Phrenosinic acid, and DL-Cerebronic acid.
What is the molecular weight of 2-Hydroxytetracosanoic acid?
The molecular weight of 2-Hydroxytetracosanoic acid is 384.6 g/mol.
Is 2-Hydroxytetracosanoic acid a natural product?
Yes, 2-Hydroxytetracosanoic acid is a natural product found in Myrmekioderma rea, Aplysina fistularis, and other organisms.
What is the IUPAC name of 2-Hydroxytetracosanoic acid?
The IUPAC name of 2-Hydroxytetracosanoic acid is 2-hydroxytetracosanoic acid.
What is the InChI of 2-Hydroxytetracosanoic acid?
The InChI of 2-Hydroxytetracosanoic acid is InChI=1S/C24H48O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(25)24(26)27/h23,25H,2-22H2,1H3,(H,26,27).
How many hydrogen bond donor counts are there in 2-Hydroxytetracosanoic acid?
There are 2 hydrogen bond donor counts in 2-Hydroxytetracosanoic acid.
How many hydrogen bond acceptor counts are there in 2-Hydroxytetracosanoic acid?
There are 3 hydrogen bond acceptor counts in 2-Hydroxytetracosanoic acid.
What is the XLogP3-AA value of 2-Hydroxytetracosanoic acid?
The XLogP3-AA value of 2-Hydroxytetracosanoic acid is 10.7.
What is the physical description of 2-Hydroxytetracosanoic acid?
2-Hydroxytetracosanoic acid is a solid.