NAVIGATION
QUICK INQUIRY
What is the molecular formula of 9-Cis-hexadecenoic acid?
The molecular formula of 9-Cis-hexadecenoic acid is C16H30O2.
What is another name for 9-Cis-hexadecenoic acid?
Another name for 9-Cis-hexadecenoic acid is palmitoleic acid.
What is the molecular weight of 9-Cis-hexadecenoic acid?
The molecular weight of 9-Cis-hexadecenoic acid is 254.41 g/mol.
What is the IUPAC name of 9-Cis-hexadecenoic acid?
The IUPAC name of 9-Cis-hexadecenoic acid is (Z)-hexadec-9-enoic acid.
What is the InChI of 9-Cis-hexadecenoic acid?
The InChI of 9-Cis-hexadecenoic acid is InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18)/b8-7-.
What is the InChIKey of 9-Cis-hexadecenoic acid?
The InChIKey of 9-Cis-hexadecenoic acid is SECPZKHBENQXJG-FPLPWBNLSA-N.
What is the canonical SMILES of 9-Cis-hexadecenoic acid?
The canonical SMILES of 9-Cis-hexadecenoic acid is CCCCCC/C=C\CCCCCCCC(=O)O.
What is the CAS number of 9-Cis-hexadecenoic acid?
The CAS number of 9-Cis-hexadecenoic acid is 373-49-9.
What is the XLogP3 value of 9-Cis-hexadecenoic acid?
The XLogP3 value of 9-Cis-hexadecenoic acid is 6.4.