NAVIGATION
QUICK INQUIRY
What is the molecular formula of (9Z,11E,13Z)-octadecatrienoic acid?
The molecular formula of (9Z,11E,13Z)-octadecatrienoic acid is C18H30O2.
What is the molecular weight of (9Z,11E,13Z)-octadecatrienoic acid?
The molecular weight of (9Z,11E,13Z)-octadecatrienoic acid is 278.4 g/mol.
What is the IUPAC name of (9Z,11E,13Z)-octadecatrienoic acid?
The IUPAC name of (9Z,11E,13Z)-octadecatrienoic acid is (9Z,11E,13Z)-octadeca-9,11,13-trienoic acid.
What is the InChIKey of (9Z,11E,13Z)-octadecatrienoic acid?
The InChIKey of (9Z,11E,13Z)-octadecatrienoic acid is CUXYLFPMQMFGPL-BGDVVUGTSA-N.
What is the canonical SMILES of (9Z,11E,13Z)-octadecatrienoic acid?
The canonical SMILES of (9Z,11E,13Z)-octadecatrienoic acid is CCCCC=CC=CC=CCCCCCCCC(=O)O.
What is the CAS number of (9Z,11E,13Z)-octadecatrienoic acid?
The CAS number of (9Z,11E,13Z)-octadecatrienoic acid is 544-72-9.
What is the ChEMBL ID of (9Z,11E,13Z)-octadecatrienoic acid?
The ChEMBL ID of (9Z,11E,13Z)-octadecatrienoic acid is CHEMBL5205249.
What is the Lipid Maps ID (LM_ID) of (9Z,11E,13Z)-octadecatrienoic acid?
The Lipid Maps ID (LM_ID) of (9Z,11E,13Z)-octadecatrienoic acid is LMFA01030146.
What is the XLogP3 value of (9Z,11E,13Z)-octadecatrienoic acid?
The XLogP3 value of (9Z,11E,13Z)-octadecatrienoic acid is 6.4.