What is the molecular formula of Delta 10 trans pentadecenoic acid ethyl ester?
The molecular formula of Delta 10 trans pentadecenoic acid ethyl ester is C16H30O2.
What are the synonyms of Delta 10 trans pentadecenoic acid ethyl ester?
The synonyms of Delta 10 trans pentadecenoic acid ethyl ester are methyl 10-pentadecenoate and methyl (E)-pentadec-10-enoate.
What is the molecular weight of Delta 10 trans pentadecenoic acid ethyl ester?
The molecular weight of Delta 10 trans pentadecenoic acid ethyl ester is 254.41 g/mol.
What is the IUPAC name of Delta 10 trans pentadecenoic acid ethyl ester?
The IUPAC name of Delta 10 trans pentadecenoic acid ethyl ester is methyl (E)-pentadec-10-enoate.
What is the InChI of Delta 10 trans pentadecenoic acid ethyl ester?
The InChI of Delta 10 trans pentadecenoic acid ethyl ester is InChI=1S/C16H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18-2/h6-7H,3-5,8-15H2,1-2H3/b7-6+.
What is the InChIKey of Delta 10 trans pentadecenoic acid ethyl ester?
The InChIKey of Delta 10 trans pentadecenoic acid ethyl ester is JEDIPLFNJDRCFD-VOTSOKGWSA-N.
What is the canonical SMILES of Delta 10 trans pentadecenoic acid ethyl ester?
The canonical SMILES of Delta 10 trans pentadecenoic acid ethyl ester is CCCCC=CCCCCCCCCC(=O)OC.
What is the isomeric SMILES of Delta 10 trans pentadecenoic acid ethyl ester?
The isomeric SMILES of Delta 10 trans pentadecenoic acid ethyl ester is CCCC/C=C/CCCCCCCCC(=O)OC.
What is the XLogP3-AA value of Delta 10 trans pentadecenoic acid ethyl ester?
The XLogP3-AA value of Delta 10 trans pentadecenoic acid ethyl ester is 6.
Is Delta 10 trans pentadecenoic acid ethyl ester a canonicalized compound?
Yes, Delta 10 trans pentadecenoic acid ethyl ester is a canonicalized compound.
