NAVIGATION
QUICK INQUIRY
Wang F, et al. Carbohydrate polymers, 2011, 84(3): 1192-1200.
A novel conjugate was prepared using deoxycholic acid (DOCA), O-carboxymethylated chitosan (OCMC) and folic acid (FA), which can be used in cancer-targeted drug delivery systems.
Synthesis of Conjugates
· Modification of OCMC with DOCA: OCMC was hydrophobically modified with DOCA to obtain a new amphiphilic polymer. To activate the carboxylic acid groups of DOCA in dried DMSO, equal amounts of EDC and NHS were added into the solution, which allowing the formation of an amide linkage by the reaction with primary amino groups in OCMC.
· Synthesis of DOMC-FA conjugates: Folate was attached to the surface amino groups of DOMC via a carbodiimide reaction.
What is the molecular formula of deoxycholic acid?
The molecular formula of deoxycholic acid is C24H40O4.
What is the molecular weight of deoxycholic acid?
The molecular weight of deoxycholic acid is 392.6 g/mol.
What is the IUPAC name of deoxycholic acid?
The IUPAC name of deoxycholic acid is (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
What is the InChIKey of deoxycholic acid?
The InChIKey of deoxycholic acid is KXGVEGMKQFWNSR-LLQZFEROSA-N.
What is the canonical SMILES of deoxycholic acid?
The canonical SMILES of deoxycholic acid is CC(CCC(=O)O)C1CCC2C1(C(CC3C2CCC4C3(CCC(C4)O)C)O)C.
What is the CAS number of deoxycholic acid?
The CAS number of deoxycholic acid is 83-44-3.
What is the EC number of deoxycholic acid?
The EC number of deoxycholic acid is 201-478-5.
What is the UNII of deoxycholic acid?
The UNII of deoxycholic acid is 005990WHZZ.
What is the ChEMBL ID of deoxycholic acid?
The ChEMBL ID of deoxycholic acid is CHEMBL406393.
What is the Wikipedia page for deoxycholic acid?
The Wikipedia page for deoxycholic acid is "Deoxycholic_acid".