NAVIGATION
QUICK INQUIRY
What is the molecular formula of 1,1-Dimethyl-5-methyleneheptyl valerate?
The molecular formula of 1,1-Dimethyl-5-methyleneheptyl valerate is C15H28O2.
What is the molecular weight of 1,1-Dimethyl-5-methyleneheptyl valerate?
The molecular weight of 1,1-Dimethyl-5-methyleneheptyl valerate is 240.38 g/mol.
What is the IUPAC name of 1,1-Dimethyl-5-methyleneheptyl valerate?
The IUPAC name of 1,1-Dimethyl-5-methyleneheptyl valerate is (2-methyl-6-methylideneoctan-2-yl) pentanoate.
What is the InChI of 1,1-Dimethyl-5-methyleneheptyl valerate?
The InChI of 1,1-Dimethyl-5-methyleneheptyl valerate is InChI=1S/C15H28O2/c1-6-8-11-14(16)17-15(4,5)12-9-10-13(3)7-2/h3,6-12H2,1-2,4-5H3.
What is the InChIKey of 1,1-Dimethyl-5-methyleneheptyl valerate?
The InChIKey of 1,1-Dimethyl-5-methyleneheptyl valerate is AHRBCOJLJNGMPZ-UHFFFAOYSA-N.
What is the canonical SMILES of 1,1-Dimethyl-5-methyleneheptyl valerate?
The canonical SMILES of 1,1-Dimethyl-5-methyleneheptyl valerate is CCCCC(=O)OC(C)(C)CCCC(=C)CC.
What is the CAS number of 1,1-Dimethyl-5-methyleneheptyl valerate?
The CAS number of 1,1-Dimethyl-5-methyleneheptyl valerate is 96846-65-0.
What is the XLogP3-AA value of 1,1-Dimethyl-5-methyleneheptyl valerate?
The XLogP3-AA value of 1,1-Dimethyl-5-methyleneheptyl valerate is 5.
How many hydrogen bond acceptors are there in 1,1-Dimethyl-5-methyleneheptyl valerate?
There are 2 hydrogen bond acceptors in 1,1-Dimethyl-5-methyleneheptyl valerate.
Is 1,1-Dimethyl-5-methyleneheptyl valerate a canonicalized compound?
Yes, 1,1-Dimethyl-5-methyleneheptyl valerate is a canonicalized compound.
