NAVIGATION
QUICK INQUIRY
What is the molecular formula of Dioctanoin?
The molecular formula of Dioctanoin is C19H36O5.
What are some synonyms for Dioctanoin?
Some synonyms for Dioctanoin include 1,2-Dioctanoylglycerol, DICAPRYLIN, and MONOCTANOIN COMPONENT C.
What is the molecular weight of Dioctanoin?
The molecular weight of Dioctanoin is 344.5 g/mol.
When was Dioctanoin created?
Dioctanoin was created on March 25, 2005.
What is the IUPAC Name of Dioctanoin?
The IUPAC Name of Dioctanoin is (3-hydroxy-2-octanoyloxypropyl) octanoate.
What is the InChI of Dioctanoin?
The InChI of Dioctanoin is InChI=1S/C19H36O5/c1-3-5-7-9-11-13-18(21)23-16-17(15-20)24-19(22)14-12-10-8-6-4-2/h17,20H,3-16H2,1-2H3.
What is the Canonical SMILES of Dioctanoin?
The Canonical SMILES of Dioctanoin is CCCCCCCC(=O)OCC(CO)OC(=O)CCCCCCC.
What is the CAS number of Dioctanoin?
The CAS number of Dioctanoin is 1069-87-0.
What is the XLogP3-AA value of Dioctanoin?
The XLogP3-AA value of Dioctanoin is 5.4.
What is the hydrogen bond acceptor count of Dioctanoin?
The hydrogen bond acceptor count of Dioctanoin is 5.
