NAVIGATION
QUICK INQUIRY
What is the molecular formula of Monomyristin?
The molecular formula of Monomyristin is C17H34O4.
What is the molecular weight of Monomyristin?
The molecular weight of Monomyristin is 302.4 g/mol.
When was Monomyristin created and modified?
Monomyristin was created on March 26, 2005, and modified on December 30, 2023.
What is the IUPAC Name of Monomyristin?
The IUPAC Name of Monomyristin is 2,3-dihydroxypropyl tetradecanoate.
What is the InChI of Monomyristin?
The InChI of Monomyristin is InChI=1S/C17H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(20)21-15-16(19)14-18/h16,18-19H,2-15H2,1H3.
What is the InChIKey of Monomyristin?
The InChIKey of Monomyristin is DCBSHORRWZKAKO-UHFFFAOYSA-N.
What is the Canonical SMILES of Monomyristin?
The Canonical SMILES of Monomyristin is CCCCCCCCCCCCCC(=O)OCC(CO)O.
What are some synonyms of Monomyristin?
Some synonyms of Monomyristin include 2,3-Dihydroxypropyl tetradecanoate, 1-Monomyristin, and 1-Myristoyl-rac-glycerol.
What is the CAS number of Monomyristin?
The CAS number of Monomyristin is 589-68-4.
What is the ChEMBL ID of Monomyristin?
The ChEMBL ID of Monomyristin is CHEMBL463092.
What are the synonyms of Monomyristin?
The synonyms of Monomyristin include 2,3-Dihydroxypropyl tetradecanoate, 1-Monomyristin, and 1-Myristoyl-rac-glycerol.
What is the hydrogen bond donor count of Monomyristin?
The hydrogen bond donor count of Monomyristin is 2.
What is the hydrogen bond acceptor count of Monomyristin?
The hydrogen bond acceptor count of Monomyristin is 4.
