1-Piperazineethanol,4-amino--alpha--methyl-

What is the molecular formula of 1-Piperazineethanol, 4-amino-alpha-methyl?

The molecular formula is C7H17N3O.

What is the molecular weight of 1-Piperazineethanol, 4-amino-alpha-methyl?

The molecular weight is 159.23 g/mol.

What is the IUPAC name of 1-Piperazineethanol, 4-amino-alpha-methyl?

The IUPAC name is 1-(4-aminopiperazin-1-yl)propan-2-ol.

What is the InChI of 1-Piperazineethanol, 4-amino-alpha-methyl?

The InChI is InChI=1S/C7H17N3O/c1-7(11)6-9-2-4-10(8)5-3-9/h7,11H,2-6,8H2,1H3.

What is the InChIKey of 1-Piperazineethanol, 4-amino-alpha-methyl?

The InChIKey is GFYHLQCKVVUBSK-UHFFFAOYSA-N.

What is the Canonical SMILES of 1-Piperazineethanol, 4-amino-alpha-methyl?

The Canonical SMILES is CC(CN1CCN(CC1)N)O.

What is the XLogP3-AA value of 1-Piperazineethanol, 4-amino-alpha-methyl?

The XLogP3-AA value is -0.9.

How many hydrogen bond donor counts does 1-Piperazineethanol, 4-amino-alpha-methyl have?

It has 2 hydrogen bond donor counts.

What is the topological polar surface area of 1-Piperazineethanol, 4-amino-alpha-methyl?

The topological polar surface area is 52.7 Å2.

Is the compound canonicalized according to PubChem?

Yes, the compound is canonicalized.