NAVIGATION
QUICK INQUIRY
What is the molecular formula of Triethanolamine palmitate?
The molecular formula of Triethanolamine palmitate is C22H47NO5.
What is the molecular weight of Triethanolamine palmitate?
The molecular weight of Triethanolamine palmitate is 405.6 g/mol.
What are some synonyms for Triethanolamine palmitate?
Some synonyms for Triethanolamine palmitate are TEA-Palmitate, QV8D9F3UKB, and 2-[bis(2-hydroxyethyl)amino]ethanol;hexadecanoic acid.
What are the component compounds of Triethanolamine palmitate?
The component compounds of Triethanolamine palmitate are Triethanolamine (CID 7618) and Palmitic Acid (CID 985).
When was Triethanolamine palmitate created and modified?
Triethanolamine palmitate was created on August 8, 2005, and last modified on November 25, 2023.
What is the IUPAC name of Triethanolamine palmitate?
The IUPAC name of Triethanolamine palmitate is 2-[bis(2-hydroxyethyl)amino]ethanol;hexadecanoic acid.
What is the InChI of Triethanolamine palmitate?
The InChI of Triethanolamine palmitate is InChI=1S/C16H32O2.C6H15NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;8-4-1-7(2-5-9)3-6-10/h2-15H2,1H3,(H,17,18);8-10H,1-6H2.
What is the InChIKey of Triethanolamine palmitate?
The InChIKey of Triethanolamine palmitate is WYVGZXIHGGQSQN-UHFFFAOYSA-N.
What is the canonical SMILES of Triethanolamine palmitate?
The canonical SMILES of Triethanolamine palmitate is CCCCCCCCCCCCCCCC(=O)O.C(CO)N(CCO)CCO.
What is the CAS number of Triethanolamine palmitate?
The CAS number of Triethanolamine palmitate is 49719-60-0.
